C36H63ClSi3 — CID 15258551
[3-[2-chloro-2-tri(propan-2-yl)silylethenylidene]-7-tri(propan-2-yl)silylhepta-1,4,6-triynyl]-tri(propan-2-yl)silane (PubChem CID 15258551) has the molecular formula C36H63ClSi3 and a molecular weight of 615.61 g/mol. Its IUPAC name is [3-[2-chloro-2-tri(propan-2-yl)silylethenylidene]-7-tri(propan-2-yl)silylhepta-1,4,6-triynyl]-tri(propan-2-yl)silane.
| Compound Name | [3-[2-chloro-2-tri(propan-2-yl)silylethenylidene]-7-tri(propan-2-yl)silylhepta-1,4,6-triynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 15258551 |
| Molecular Formula | C36H63ClSi3 |
| Molecular Weight | 615.61 g/mol |
| Exact Mass | 614.39 |
| IUPAC Name | [3-[2-chloro-2-tri(propan-2-yl)silylethenylidene]-7-tri(propan-2-yl)silylhepta-1,4,6-triynyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC#CC(=C=C(Cl)[Si](C(C)C)(C(C)C)C(C)C)C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H63ClSi3/c1-26(2)38(27(3)4,28(5)6)23-20-19-21-35(22-24-39(29(7)8,30(9)10)31(11)12)25-36(37)40(32(13)14,33(15)16)34(17)18/h26-34H,1-18H3 |
| InChIKey | LKJBMVPEPHRNLI-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.61 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|