About ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate
ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate (PubChem CID 15258659) has the molecular formula C10H8N2O5
and a molecular weight of 236.18 g/mol. Its IUPAC name is ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate |
| PubChem CID | 15258659 |
| Molecular Formula | C10H8N2O5 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)[nH]cnc2oc1=O |
| InChI | InChI=1S/C10H8N2O5/c1-2-16-9(14)6-3-5-7(13)11-4-12-8(5)17-10(6)15/h3-4H,2H2,1H3,(H,11,12,13) |
| InChIKey | MPAIUIPOSVFYLA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate?
The IUPAC name of ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate (CID 15258659) is ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate.
What is the SMILES notation for ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate?
The canonical SMILES for ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate is CCOC(=O)c1cc2c(=O)[nH]cnc2oc1=O.
What is the InChIKey of ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate?
The InChIKey is MPAIUIPOSVFYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O5/c1-2-16-9(14)6-3-5-7(13)11-4-12-8(5)17-10(6)15/h3-4H,2H2,1H3,(H,11,12,13).
What are the key properties of ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate?
ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate has a molecular weight of 236.18 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4,7-dioxo-3H-pyrano[2,3-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 15258659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).