C15H16Cl2N2O2 — CID 152588917
methyl 1-[[4-[amino(chloro)amino]phenyl]methyl]-4-chlorocyclohexa-2,4-diene-1-carboxylate (PubChem CID 152588917) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is methyl 1-[[4-[amino(chloro)amino]phenyl]methyl]-4-chlorocyclohexa-2,4-diene-1-carboxylate.
| Compound Name | methyl 1-[[4-[amino(chloro)amino]phenyl]methyl]-4-chlorocyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 152588917 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | methyl 1-[[4-[amino(chloro)amino]phenyl]methyl]-4-chlorocyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)C1(Cc2ccc(N(N)Cl)cc2)C=CC(Cl)=CC1 |
| InChI | InChI=1S/C15H16Cl2N2O2/c1-21-14(20)15(8-6-12(16)7-9-15)10-11-2-4-13(5-3-11)19(17)18/h2-8H,9-10,18H2,1H3 |
| InChIKey | YVBCFIMUEBVVGY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|