C16H15NO3 — CID 15259306
4-benzyl-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 15259306) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-benzyl-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylic acid.
| Compound Name | 4-benzyl-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 15259306 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-benzyl-2,3-dimethylfuro[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | Cc1oc2cc(C(=O)O)n(Cc3ccccc3)c2c1C |
| InChI | InChI=1S/C16H15NO3/c1-10-11(2)20-14-8-13(16(18)19)17(15(10)14)9-12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | PXVSWYXKBNEYFD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |