C10H2F12O — CID 15259501
2,3,5,6-tetrakis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 15259501) has the molecular formula C10H2F12O and a molecular weight of 366.10 g/mol. Its IUPAC name is 2,3,5,6-tetrakis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2,3,5,6-tetrakis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 15259501 |
| Molecular Formula | C10H2F12O |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 2,3,5,6-tetrakis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C2OC1C(C(F)(F)F)=C2C(F)(F)F |
| InChI | InChI=1S/C10H2F12O/c11-7(12,13)1-2(8(14,15)16)6-4(10(20,21)22)3(5(1)23-6)9(17,18)19/h5-6H |
| InChIKey | LCAOFCHOHNAXHS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|