About 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one
6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one (PubChem CID 152597425) has the molecular formula C22H24N6O2
and a molecular weight of 404.47 g/mol. Its IUPAC name is 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one |
| PubChem CID | 152597425 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one |
| SMILES | CCCOc1ccccc1-c1nc2c(CCC)n(-c3cnccn3)nc2c(=O)n1C |
| InChI | InChI=1S/C22H24N6O2/c1-4-8-16-19-20(26-28(16)18-14-23-11-12-24-18)22(29)27(3)21(25-19)15-9-6-7-10-17(15)30-13-5-2/h6-7,9-12,14H,4-5,8,13H2,1-3H3 |
| InChIKey | YWUHVCKMCOSIOV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one?
The IUPAC name of 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one (CID 152597425) is 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one.
What is the SMILES notation for 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one?
The canonical SMILES for 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one is CCCOc1ccccc1-c1nc2c(CCC)n(-c3cnccn3)nc2c(=O)n1C.
What is the InChIKey of 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one?
The InChIKey is YWUHVCKMCOSIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N6O2/c1-4-8-16-19-20(26-28(16)18-14-23-11-12-24-18)22(29)27(3)21(25-19)15-9-6-7-10-17(15)30-13-5-2/h6-7,9-12,14H,4-5,8,13H2,1-3H3.
What are the key properties of 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one?
6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one has a molecular weight of 404.47 g/mol, XLogP of 3.32, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-(2-propoxyphenyl)-3-propyl-2-pyrazin-2-ylpyrazolo[4,3-d]pyrimidin-7-one is sourced from PubChem (CID 152597425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).