C33H43F3N6O2Si — CID 152599048
4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-N-[(1S,2S)-2-pyrrolidin-1-ylcyclopentyl]-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 152599048) has the molecular formula C33H43F3N6O2Si and a molecular weight of 640.83 g/mol. Its IUPAC name is 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-N-[(1S,2S)-2-pyrrolidin-1-ylcyclopentyl]-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-N-[(1S,2S)-2-pyrrolidin-1-ylcyclopentyl]-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 152599048 |
| Molecular Formula | C33H43F3N6O2Si |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.32 |
| IUPAC Name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-N-[(1S,2S)-2-pyrrolidin-1-ylcyclopentyl]-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Cc1noc(C)c1-c1ccc2c(-c3nc(N[C@H]4CCC[C@@H]4N4CCCC4)ncc3C(F)(F)F)cn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C33H43F3N6O2Si/c1-21-30(22(2)44-40-21)23-11-12-24-25(19-42(29(24)17-23)20-43-15-16-45(3,4)5)31-26(33(34,35)36)18-37-32(39-31)38-27-9-8-10-28(27)41-13-6-7-14-41/h11-12,17-19,27-28H,6-10,13-16,20H2,1-5H3,(H,37,38,39)/t27-,28-/m0/s1 |
| InChIKey | YXCYKKYVGWOIBB-NSOVKSMOSA-N |
| XLogP | 8.13 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|