About 3-methylphenoxathiine 10,10-dioxide
3-methylphenoxathiine 10,10-dioxide (PubChem CID 15259943) has the molecular formula C13H10O3S
and a molecular weight of 246.29 g/mol. Its IUPAC name is 3-methylphenoxathiine 10,10-dioxide.
Molecular Properties
| Compound Name | 3-methylphenoxathiine 10,10-dioxide |
| PubChem CID | 15259943 |
| Molecular Formula | C13H10O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 3-methylphenoxathiine 10,10-dioxide |
| SMILES | Cc1ccc2c(c1)Oc1ccccc1S2(=O)=O |
| InChI | InChI=1S/C13H10O3S/c1-9-6-7-13-11(8-9)16-10-4-2-3-5-12(10)17(13,14)15/h2-8H,1H3 |
| InChIKey | CBLCADUNWWRLLJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylphenoxathiine 10,10-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylphenoxathiine 10,10-dioxide?
The IUPAC name of 3-methylphenoxathiine 10,10-dioxide (CID 15259943) is 3-methylphenoxathiine 10,10-dioxide.
What is the SMILES notation for 3-methylphenoxathiine 10,10-dioxide?
The canonical SMILES for 3-methylphenoxathiine 10,10-dioxide is Cc1ccc2c(c1)Oc1ccccc1S2(=O)=O.
What is the InChIKey of 3-methylphenoxathiine 10,10-dioxide?
The InChIKey is CBLCADUNWWRLLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3S/c1-9-6-7-13-11(8-9)16-10-4-2-3-5-12(10)17(13,14)15/h2-8H,1H3.
What are the key properties of 3-methylphenoxathiine 10,10-dioxide?
3-methylphenoxathiine 10,10-dioxide has a molecular weight of 246.29 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylphenoxathiine 10,10-dioxide is sourced from PubChem (CID 15259943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).