C12H22BIO2 — CID 15260001
2-[(E)-6-iodohex-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 15260001) has the molecular formula C12H22BIO2 and a molecular weight of 336.02 g/mol. Its IUPAC name is 2-[(E)-6-iodohex-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-6-iodohex-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 15260001 |
| Molecular Formula | C12H22BIO2 |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[(E)-6-iodohex-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(/C=C/CCCCI)OC1(C)C |
| InChI | InChI=1S/C12H22BIO2/c1-11(2)12(3,4)16-13(15-11)9-7-5-6-8-10-14/h7,9H,5-6,8,10H2,1-4H3/b9-7+ |
| InChIKey | CGNCUZDRLPEHKT-VQHVLOKHSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|