C11H17F3N2O3 — CID 152602216
methyl 4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]butanoate (PubChem CID 152602216) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is methyl 4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]butanoate.
| Compound Name | methyl 4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 152602216 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | methyl 4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3N2O3/c1-19-9(17)3-2-4-15-5-7-16(8-6-15)10(18)11(12,13)14/h2-8H2,1H3 |
| InChIKey | YXTVQTRAIPNWKF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |