About S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate
S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate (PubChem CID 15260240) has the molecular formula C17H11ClF2O3S2
and a molecular weight of 400.86 g/mol. Its IUPAC name is S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate.
Molecular Properties
| Compound Name | S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate |
| PubChem CID | 15260240 |
| Molecular Formula | C17H11ClF2O3S2 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate |
| SMILES | CC(=O)SSC(Cl)(C(=O)c1ccc(F)cc1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H11ClF2O3S2/c1-10(21)24-25-17(18,15(22)11-2-6-13(19)7-3-11)16(23)12-4-8-14(20)9-5-12/h2-9H,1H3 |
| InChIKey | SICWQNOQUUGDQC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate?
The IUPAC name of S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate (CID 15260240) is S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate.
What is the SMILES notation for S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate?
The canonical SMILES for S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate is CC(=O)SSC(Cl)(C(=O)c1ccc(F)cc1)C(=O)c1ccc(F)cc1.
What is the InChIKey of S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate?
The InChIKey is SICWQNOQUUGDQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClF2O3S2/c1-10(21)24-25-17(18,15(22)11-2-6-13(19)7-3-11)16(23)12-4-8-14(20)9-5-12/h2-9H,1H3.
What are the key properties of S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate?
S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate has a molecular weight of 400.86 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl]sulfanyl ethanethioate is sourced from PubChem (CID 15260240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).