C11H14N2O6 — CID 152608992
butyl 5,5-dinitrocyclohexa-1,3-diene-1-carboxylate (PubChem CID 152608992) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is butyl 5,5-dinitrocyclohexa-1,3-diene-1-carboxylate.
| Compound Name | butyl 5,5-dinitrocyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 152608992 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | butyl 5,5-dinitrocyclohexa-1,3-diene-1-carboxylate |
| SMILES | CCCCOC(=O)C1=CC=CC([N+](=O)[O-])([N+](=O)[O-])C1 |
| InChI | InChI=1S/C11H14N2O6/c1-2-3-7-19-10(14)9-5-4-6-11(8-9,12(15)16)13(17)18/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | YZCQTIVASSWCOG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|