C11H25NO — CID 15260996
(3R,5S)-5-amino-2,2,6,6-tetramethylheptan-3-ol (PubChem CID 15260996) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is (3R,5S)-5-amino-2,2,6,6-tetramethylheptan-3-ol.
| Compound Name | (3R,5S)-5-amino-2,2,6,6-tetramethylheptan-3-ol |
|---|---|
| PubChem CID | 15260996 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | (3R,5S)-5-amino-2,2,6,6-tetramethylheptan-3-ol |
| SMILES | CC(C)(C)[C@H](O)C[C@H](N)C(C)(C)C |
| InChI | InChI=1S/C11H25NO/c1-10(2,3)8(12)7-9(13)11(4,5)6/h8-9,13H,7,12H2,1-6H3/t8-,9+/m0/s1 |
| InChIKey | XYYVNVSVGSELNW-DTWKUNHWSA-N |
| XLogP | 2.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |