About 2-methyl-N-nonyl-1,3-thiazol-4-amine
2-methyl-N-nonyl-1,3-thiazol-4-amine (PubChem CID 152613568) has the molecular formula C13H24N2S
and a molecular weight of 240.42 g/mol. Its IUPAC name is 2-methyl-N-nonyl-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-methyl-N-nonyl-1,3-thiazol-4-amine |
| PubChem CID | 152613568 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-methyl-N-nonyl-1,3-thiazol-4-amine |
| SMILES | CCCCCCCCCNc1csc(C)n1 |
| InChI | InChI=1S/C13H24N2S/c1-3-4-5-6-7-8-9-10-14-13-11-16-12(2)15-13/h11,14H,3-10H2,1-2H3 |
| InChIKey | ZAAORMHODHTDFJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-nonyl-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-nonyl-1,3-thiazol-4-amine?
The IUPAC name of 2-methyl-N-nonyl-1,3-thiazol-4-amine (CID 152613568) is 2-methyl-N-nonyl-1,3-thiazol-4-amine.
What is the SMILES notation for 2-methyl-N-nonyl-1,3-thiazol-4-amine?
The canonical SMILES for 2-methyl-N-nonyl-1,3-thiazol-4-amine is CCCCCCCCCNc1csc(C)n1.
What is the InChIKey of 2-methyl-N-nonyl-1,3-thiazol-4-amine?
The InChIKey is ZAAORMHODHTDFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2S/c1-3-4-5-6-7-8-9-10-14-13-11-16-12(2)15-13/h11,14H,3-10H2,1-2H3.
What are the key properties of 2-methyl-N-nonyl-1,3-thiazol-4-amine?
2-methyl-N-nonyl-1,3-thiazol-4-amine has a molecular weight of 240.42 g/mol, XLogP of 4.61, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-nonyl-1,3-thiazol-4-amine is sourced from PubChem (CID 152613568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).