About 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol
4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol (PubChem CID 152613688) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol.
Molecular Properties
| Compound Name | 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol |
| PubChem CID | 152613688 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol |
| SMILES | CC(C1=CCC(C)(O)C=C1)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H18O2/c1-11(12-3-5-14(16)6-4-12)13-7-9-15(2,17)10-8-13/h3-9,11,16-17H,10H2,1-2H3 |
| InChIKey | ZABFPJOIJMEXMY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol?
The IUPAC name of 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol (CID 152613688) is 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol.
What is the SMILES notation for 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol?
The canonical SMILES for 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol is CC(C1=CCC(C)(O)C=C1)c1ccc(O)cc1.
What is the InChIKey of 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol?
The InChIKey is ZABFPJOIJMEXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2/c1-11(12-3-5-14(16)6-4-12)13-7-9-15(2,17)10-8-13/h3-9,11,16-17H,10H2,1-2H3.
What are the key properties of 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol?
4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol has a molecular weight of 230.31 g/mol, XLogP of 3.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-hydroxy-4-methylcyclohexa-1,5-dien-1-yl)ethyl]phenol is sourced from PubChem (CID 152613688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).