C14H23NO4 — CID 152614197
4-(cyclohexylamino)cyclohexane-1,1-dicarboxylic acid (PubChem CID 152614197) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-(cyclohexylamino)cyclohexane-1,1-dicarboxylic acid.
| Compound Name | 4-(cyclohexylamino)cyclohexane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 152614197 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-(cyclohexylamino)cyclohexane-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CCC(NC2CCCCC2)CC1 |
| InChI | InChI=1S/C14H23NO4/c16-12(17)14(13(18)19)8-6-11(7-9-14)15-10-4-2-1-3-5-10/h10-11,15H,1-9H2,(H,16,17)(H,18,19) |
| InChIKey | ZADVAQCOUHUMJO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|