About 1-(chloromethyl)-1,2-dimethylhydrazine
1-(chloromethyl)-1,2-dimethylhydrazine (PubChem CID 152614480) has the molecular formula C3H9ClN2
and a molecular weight of 108.57 g/mol. Its IUPAC name is 1-(chloromethyl)-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-(chloromethyl)-1,2-dimethylhydrazine |
| PubChem CID | 152614480 |
| Molecular Formula | C3H9ClN2 |
| Molecular Weight | 108.57 g/mol |
| Exact Mass | 108.05 |
| IUPAC Name | 1-(chloromethyl)-1,2-dimethylhydrazine |
| SMILES | CNN(C)CCl |
| InChI | InChI=1S/C3H9ClN2/c1-5-6(2)3-4/h5H,3H2,1-2H3 |
| InChIKey | ZAFHDCRWPIHTJY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.57 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethyl)-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethyl)-1,2-dimethylhydrazine?
The IUPAC name of 1-(chloromethyl)-1,2-dimethylhydrazine (CID 152614480) is 1-(chloromethyl)-1,2-dimethylhydrazine.
What is the SMILES notation for 1-(chloromethyl)-1,2-dimethylhydrazine?
The canonical SMILES for 1-(chloromethyl)-1,2-dimethylhydrazine is CNN(C)CCl.
What is the InChIKey of 1-(chloromethyl)-1,2-dimethylhydrazine?
The InChIKey is ZAFHDCRWPIHTJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9ClN2/c1-5-6(2)3-4/h5H,3H2,1-2H3.
What are the key properties of 1-(chloromethyl)-1,2-dimethylhydrazine?
1-(chloromethyl)-1,2-dimethylhydrazine has a molecular weight of 108.57 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethyl)-1,2-dimethylhydrazine is sourced from PubChem (CID 152614480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).