C14H14F2O4S — CID 15261518
[(3Z,5E)-1,1-difluoro-2-oxohepta-3,5-dien-3-yl] 4-methylbenzenesulfonate (PubChem CID 15261518) has the molecular formula C14H14F2O4S and a molecular weight of 316.33 g/mol. Its IUPAC name is [(3Z,5E)-1,1-difluoro-2-oxohepta-3,5-dien-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3Z,5E)-1,1-difluoro-2-oxohepta-3,5-dien-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15261518 |
| Molecular Formula | C14H14F2O4S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [(3Z,5E)-1,1-difluoro-2-oxohepta-3,5-dien-3-yl] 4-methylbenzenesulfonate |
| SMILES | C/C=C/C=C(\OS(=O)(=O)c1ccc(C)cc1)C(=O)C(F)F |
| InChI | InChI=1S/C14H14F2O4S/c1-3-4-5-12(13(17)14(15)16)20-21(18,19)11-8-6-10(2)7-9-11/h3-9,14H,1-2H3/b4-3+,12-5- |
| InChIKey | ZYEJGHTWESWOKH-UBXZVMTISA-N |
| XLogP | 2.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|