About tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate
tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate (PubChem CID 15261837) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate.
Molecular Properties
| Compound Name | tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate |
| PubChem CID | 15261837 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate |
| SMILES | C#C[C@@H](O)C[C@@H](O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H18O4/c1-5-8(12)6-9(13)7-10(14)15-11(2,3)4/h1,8-9,12-13H,6-7H2,2-4H3/t8-,9-/m1/s1 |
| InChIKey | LLHIWZPUCMGIPR-RKDXNWHRSA-N |
| XLogP | 0.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate?
The IUPAC name of tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate (CID 15261837) is tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate.
What is the SMILES notation for tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate?
The canonical SMILES for tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate is C#C[C@@H](O)C[C@@H](O)CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate?
The InChIKey is LLHIWZPUCMGIPR-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H18O4/c1-5-8(12)6-9(13)7-10(14)15-11(2,3)4/h1,8-9,12-13H,6-7H2,2-4H3/t8-,9-/m1/s1.
What are the key properties of tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate?
tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate has a molecular weight of 214.26 g/mol, XLogP of 0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R,5S)-3,5-dihydroxyhept-6-ynoate is sourced from PubChem (CID 15261837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).