About 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate
1-(8-methylnonanoyloxy)butyl 8-methylnonanoate (PubChem CID 152618538) has the molecular formula C24H46O4
and a molecular weight of 398.63 g/mol. Its IUPAC name is 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate.
Molecular Properties
| Compound Name | 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate |
| PubChem CID | 152618538 |
| Molecular Formula | C24H46O4 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate |
| SMILES | CCCC(OC(=O)CCCCCCC(C)C)OC(=O)CCCCCCC(C)C |
| InChI | InChI=1S/C24H46O4/c1-6-15-24(27-22(25)18-13-9-7-11-16-20(2)3)28-23(26)19-14-10-8-12-17-21(4)5/h20-21,24H,6-19H2,1-5H3 |
| InChIKey | ZBAMFTKLTDPFSW-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate?
The IUPAC name of 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate (CID 152618538) is 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate.
What is the SMILES notation for 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate?
The canonical SMILES for 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate is CCCC(OC(=O)CCCCCCC(C)C)OC(=O)CCCCCCC(C)C.
What is the InChIKey of 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate?
The InChIKey is ZBAMFTKLTDPFSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O4/c1-6-15-24(27-22(25)18-13-9-7-11-16-20(2)3)28-23(26)19-14-10-8-12-17-21(4)5/h20-21,24H,6-19H2,1-5H3.
What are the key properties of 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate?
1-(8-methylnonanoyloxy)butyl 8-methylnonanoate has a molecular weight of 398.63 g/mol, XLogP of 7.19, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-methylnonanoyloxy)butyl 8-methylnonanoate is sourced from PubChem (CID 152618538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).