C17H22O4 — CID 152620296
5-(4-ethylidenecyclohexyl)-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 152620296) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 5-(4-ethylidenecyclohexyl)-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 5-(4-ethylidenecyclohexyl)-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 152620296 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 5-(4-ethylidenecyclohexyl)-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC=C1CCC(C2=CC(C)(C(=O)O)CC(C(=O)O)=C2)CC1 |
| InChI | InChI=1S/C17H22O4/c1-3-11-4-6-12(7-5-11)13-8-14(15(18)19)10-17(2,9-13)16(20)21/h3,8-9,12H,4-7,10H2,1-2H3,(H,18,19)(H,20,21)/b11-3- |
| InChIKey | ZBJHYCIADJCFLO-JYOAFUTRSA-N |
| XLogP | 3.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|