C12H8Cl3N3O2S — CID 15262157
2,3,5-trichloro-6-[2-(2-propan-2-ylidenehydrazinyl)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 15262157) has the molecular formula C12H8Cl3N3O2S and a molecular weight of 364.64 g/mol. Its IUPAC name is 2,3,5-trichloro-6-[2-(2-propan-2-ylidenehydrazinyl)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trichloro-6-[2-(2-propan-2-ylidenehydrazinyl)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15262157 |
| Molecular Formula | C12H8Cl3N3O2S |
| Molecular Weight | 364.64 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | 2,3,5-trichloro-6-[2-(2-propan-2-ylidenehydrazinyl)-1,3-thiazol-5-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=NNc1ncc(C2=C(Cl)C(=O)C(Cl)=C(Cl)C2=O)s1 |
| InChI | InChI=1S/C12H8Cl3N3O2S/c1-4(2)17-18-12-16-3-5(21-12)6-7(13)11(20)9(15)8(14)10(6)19/h3H,1-2H3,(H,16,18) |
| InChIKey | KQEKESHWNQTFNJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|