About [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid
[4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid (PubChem CID 152623149) has the molecular formula C5H9NO5
and a molecular weight of 163.13 g/mol. Its IUPAC name is [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid |
| PubChem CID | 152623149 |
| Molecular Formula | C5H9NO5 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid |
| SMILES | O=C(O)NC1OCC(CO)O1 |
| InChI | InChI=1S/C5H9NO5/c7-1-3-2-10-5(11-3)6-4(8)9/h3,5-7H,1-2H2,(H,8,9) |
| InChIKey | ZBYJLMOXIRHKTR-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid?
The IUPAC name of [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid (CID 152623149) is [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid.
What is the SMILES notation for [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid?
The canonical SMILES for [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid is O=C(O)NC1OCC(CO)O1.
What is the InChIKey of [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid?
The InChIKey is ZBYJLMOXIRHKTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO5/c7-1-3-2-10-5(11-3)6-4(8)9/h3,5-7H,1-2H2,(H,8,9).
What are the key properties of [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid?
[4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid has a molecular weight of 163.13 g/mol, XLogP of -1.05, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)-1,3-dioxolan-2-yl]carbamic acid is sourced from PubChem (CID 152623149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).