C15H12ClNO2 — CID 152623164
1-(chloromethyl)-6-phenylmethoxyfuro[3,4-c]pyridine (PubChem CID 152623164) has the molecular formula C15H12ClNO2 and a molecular weight of 273.72 g/mol. Its IUPAC name is 1-(chloromethyl)-6-phenylmethoxyfuro[3,4-c]pyridine.
| Compound Name | 1-(chloromethyl)-6-phenylmethoxyfuro[3,4-c]pyridine |
|---|---|
| PubChem CID | 152623164 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-(chloromethyl)-6-phenylmethoxyfuro[3,4-c]pyridine |
| SMILES | ClCc1occ2cnc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C15H12ClNO2/c16-7-14-13-6-15(17-8-12(13)10-18-14)19-9-11-4-2-1-3-5-11/h1-6,8,10H,7,9H2 |
| InChIKey | ZBYLWYLRTDRBBS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|