About 1-azidocyclohexa-2,4-dien-1-amine
1-azidocyclohexa-2,4-dien-1-amine (PubChem CID 152624506) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 1-azidocyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 1-azidocyclohexa-2,4-dien-1-amine |
| PubChem CID | 152624506 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 1-azidocyclohexa-2,4-dien-1-amine |
| SMILES | [N-]=[N+]=NC1(N)C=CC=CC1 |
| InChI | InChI=1S/C6H8N4/c7-6(9-10-8)4-2-1-3-5-6/h1-4H,5,7H2 |
| InChIKey | ZCFMPCHZWHWQTE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azidocyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidocyclohexa-2,4-dien-1-amine?
The IUPAC name of 1-azidocyclohexa-2,4-dien-1-amine (CID 152624506) is 1-azidocyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 1-azidocyclohexa-2,4-dien-1-amine?
The canonical SMILES for 1-azidocyclohexa-2,4-dien-1-amine is [N-]=[N+]=NC1(N)C=CC=CC1.
What is the InChIKey of 1-azidocyclohexa-2,4-dien-1-amine?
The InChIKey is ZCFMPCHZWHWQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c7-6(9-10-8)4-2-1-3-5-6/h1-4H,5,7H2.
What are the key properties of 1-azidocyclohexa-2,4-dien-1-amine?
1-azidocyclohexa-2,4-dien-1-amine has a molecular weight of 136.16 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidocyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 152624506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).