About (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate
(4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate (PubChem CID 152625052) has the molecular formula C14H14O5
and a molecular weight of 262.26 g/mol. Its IUPAC name is (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate.
Molecular Properties
| Compound Name | (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate |
| PubChem CID | 152625052 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate |
| SMILES | CC(=O)Oc1ccc(OC(C)=O)c2c1CCCC2=O |
| InChI | InChI=1S/C14H14O5/c1-8(15)18-12-6-7-13(19-9(2)16)14-10(12)4-3-5-11(14)17/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZCIHXIAAUDGCLT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate?
The IUPAC name of (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate (CID 152625052) is (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate.
What is the SMILES notation for (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate?
The canonical SMILES for (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate is CC(=O)Oc1ccc(OC(C)=O)c2c1CCCC2=O.
What is the InChIKey of (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate?
The InChIKey is ZCIHXIAAUDGCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O5/c1-8(15)18-12-6-7-13(19-9(2)16)14-10(12)4-3-5-11(14)17/h6-7H,3-5H2,1-2H3.
What are the key properties of (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate?
(4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate has a molecular weight of 262.26 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetyloxy-5-oxo-7,8-dihydro-6H-naphthalen-1-yl) acetate is sourced from PubChem (CID 152625052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).