C8H13ClO6 — CID 152625927
trans-(3R,5R)-2-(chloromethyl)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid (PubChem CID 152625927) has the molecular formula C8H13ClO6 and a molecular weight of 240.64 g/mol. Its IUPAC name is trans-(3R,5R)-2-(chloromethyl)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(3R,5R)-2-(chloromethyl)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 152625927 |
| Molecular Formula | C8H13ClO6 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | trans-(3R,5R)-2-(chloromethyl)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(O)C[C@@H](O)C(O)[C@H](O)C1CCl |
| InChI | InChI=1S/C8H13ClO6/c9-2-3-5(11)6(12)4(10)1-8(3,15)7(13)14/h3-6,10-12,15H,1-2H2,(H,13,14)/t3?,4-,5-,6?,8?/m1/s1 |
| InChIKey | ZCMZOEYUTBZULZ-QGIUYVOOSA-N |
| XLogP | -1.86 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|