C17H18O2 — CID 15262695
(4S,5R)-2,2-dimethyl-4,5-diphenyl-1,3-dioxolane (PubChem CID 15262695) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (4S,5R)-2,2-dimethyl-4,5-diphenyl-1,3-dioxolane.
| Compound Name | (4S,5R)-2,2-dimethyl-4,5-diphenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 15262695 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (4S,5R)-2,2-dimethyl-4,5-diphenyl-1,3-dioxolane |
| SMILES | CC1(C)O[C@H](c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C17H18O2/c1-17(2)18-15(13-9-5-3-6-10-13)16(19-17)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3/t15-,16+ |
| InChIKey | BCVTUPLNURAZHB-IYBDPMFKSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |