About 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole
5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole (PubChem CID 152627794) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole |
| PubChem CID | 152627794 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole |
| SMILES | c1cc(C2CC3OC3CCO2)[nH]n1 |
| InChI | InChI=1S/C9H12N2O2/c1-3-10-11-6(1)8-5-9-7(13-9)2-4-12-8/h1,3,7-9H,2,4-5H2,(H,10,11) |
| InChIKey | ZCWOAJUWHNSXQE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole?
The IUPAC name of 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole (CID 152627794) is 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole.
What is the SMILES notation for 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole?
The canonical SMILES for 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole is c1cc(C2CC3OC3CCO2)[nH]n1.
What is the InChIKey of 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole?
The InChIKey is ZCWOAJUWHNSXQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-3-10-11-6(1)8-5-9-7(13-9)2-4-12-8/h1,3,7-9H,2,4-5H2,(H,10,11).
What are the key properties of 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole?
5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole has a molecular weight of 180.21 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,8-dioxabicyclo[5.1.0]octan-3-yl)-1H-pyrazole is sourced from PubChem (CID 152627794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).