C21H31BClFN2O4 — CID 152628359
2-amino-6-borono-2-[1-(7-chloro-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)piperidin-4-yl]hexanoic acid (PubChem CID 152628359) has the molecular formula C21H31BClFN2O4 and a molecular weight of 440.75 g/mol. Its IUPAC name is 2-amino-6-borono-2-[1-(7-chloro-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)piperidin-4-yl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[1-(7-chloro-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)piperidin-4-yl]hexanoic acid |
|---|---|
| PubChem CID | 152628359 |
| Molecular Formula | C21H31BClFN2O4 |
| Molecular Weight | 440.75 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-amino-6-borono-2-[1-(7-chloro-6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)piperidin-4-yl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(C(=O)O)C1CCN(C2CCCc3cc(F)c(Cl)cc32)CC1 |
| InChI | InChI=1S/C21H31BClFN2O4/c23-17-13-16-14(12-18(17)24)4-3-5-19(16)26-10-6-15(7-11-26)21(25,20(27)28)8-1-2-9-22(29)30/h12-13,15,19,29-30H,1-11,25H2,(H,27,28) |
| InChIKey | ZCZKAZYRWZRIKO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.75 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|