C15H10ClF3N4O — CID 152632273
4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-3-methoxypyridine (PubChem CID 152632273) has the molecular formula C15H10ClF3N4O and a molecular weight of 354.72 g/mol. Its IUPAC name is 4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-3-methoxypyridine.
| Compound Name | 4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-3-methoxypyridine |
|---|---|
| PubChem CID | 152632273 |
| Molecular Formula | C15H10ClF3N4O |
| Molecular Weight | 354.72 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-3-methoxypyridine |
| SMILES | COc1cnccc1-c1cc(Cl)ccc1-n1cc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C15H10ClF3N4O/c1-24-13-7-20-5-4-10(13)11-6-9(16)2-3-12(11)23-8-14(21-22-23)15(17,18)19/h2-8H,1H3 |
| InChIKey | ZDUASFLTFUXNAX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.72 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |