C17H14N2O3 — CID 152634012
5-phenyl-6-phenylmethoxy-1H-pyrimidine-2,4-dione (PubChem CID 152634012) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-phenyl-6-phenylmethoxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-phenyl-6-phenylmethoxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 152634012 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-phenyl-6-phenylmethoxy-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(OCc2ccccc2)c(-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H14N2O3/c20-15-14(13-9-5-2-6-10-13)16(19-17(21)18-15)22-11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,18,19,20,21) |
| InChIKey | ZEDGNFHXDULZID-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |