About 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran
2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran (PubChem CID 15263410) has the molecular formula C11H12O4S
and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran |
| PubChem CID | 15263410 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran |
| SMILES | COC1C=CC(S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C11H12O4S/c1-14-10-7-8-11(15-10)16(12,13)9-5-3-2-4-6-9/h2-8,10-11H,1H3 |
| InChIKey | OORHUSXECIPXHS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran?
The IUPAC name of 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran (CID 15263410) is 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran.
What is the SMILES notation for 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran?
The canonical SMILES for 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran is COC1C=CC(S(=O)(=O)c2ccccc2)O1.
What is the InChIKey of 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran?
The InChIKey is OORHUSXECIPXHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4S/c1-14-10-7-8-11(15-10)16(12,13)9-5-3-2-4-6-9/h2-8,10-11H,1H3.
What are the key properties of 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran?
2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran has a molecular weight of 240.28 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-5-methoxy-2,5-dihydrofuran is sourced from PubChem (CID 15263410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).