C26H18F4O2 — CID 15263471
1,1,2,2-tetrakis(4-fluorophenyl)ethane-1,2-diol (PubChem CID 15263471) has the molecular formula C26H18F4O2 and a molecular weight of 438.42 g/mol. Its IUPAC name is 1,1,2,2-tetrakis(4-fluorophenyl)ethane-1,2-diol.
| Compound Name | 1,1,2,2-tetrakis(4-fluorophenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 15263471 |
| Molecular Formula | C26H18F4O2 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 1,1,2,2-tetrakis(4-fluorophenyl)ethane-1,2-diol |
| SMILES | OC(c1ccc(F)cc1)(c1ccc(F)cc1)C(O)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H18F4O2/c27-21-9-1-17(2-10-21)25(31,18-3-11-22(28)12-4-18)26(32,19-5-13-23(29)14-6-19)20-7-15-24(30)16-8-20/h1-16,31-32H |
| InChIKey | WCLDEYLDJTVXII-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |