C17H22N2O4 — CID 15263529
[(3aR,4S,7aS)-1-methyl-3a-(2-nitrophenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-4-yl] acetate (PubChem CID 15263529) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(3aR,4S,7aS)-1-methyl-3a-(2-nitrophenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-4-yl] acetate.
| Compound Name | [(3aR,4S,7aS)-1-methyl-3a-(2-nitrophenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-4-yl] acetate |
|---|---|
| PubChem CID | 15263529 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [(3aR,4S,7aS)-1-methyl-3a-(2-nitrophenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC[C@@H]2N(C)CC[C@]12c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N2O4/c1-12(20)23-16-9-5-8-15-17(16,10-11-18(15)2)13-6-3-4-7-14(13)19(21)22/h3-4,6-7,15-16H,5,8-11H2,1-2H3/t15-,16-,17+/m0/s1 |
| InChIKey | LTANXZVVHGTJHF-YESZJQIVSA-N |
| XLogP | 2.65 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|