C32H40FN5O — CID 152636621
2-[(2-fluorophenyl)methyl]-5-[1-[1-[1-(3-methoxypropyl)piperidin-4-yl]piperidin-4-yl]pyrazol-3-yl]-1H-indole (PubChem CID 152636621) has the molecular formula C32H40FN5O and a molecular weight of 529.70 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-5-[1-[1-[1-(3-methoxypropyl)piperidin-4-yl]piperidin-4-yl]pyrazol-3-yl]-1H-indole.
| Compound Name | 2-[(2-fluorophenyl)methyl]-5-[1-[1-[1-(3-methoxypropyl)piperidin-4-yl]piperidin-4-yl]pyrazol-3-yl]-1H-indole |
|---|---|
| PubChem CID | 152636621 |
| Molecular Formula | C32H40FN5O |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-5-[1-[1-[1-(3-methoxypropyl)piperidin-4-yl]piperidin-4-yl]pyrazol-3-yl]-1H-indole |
| SMILES | COCCCN1CCC(N2CCC(n3ccc(-c4ccc5[nH]c(Cc6ccccc6F)cc5c4)n3)CC2)CC1 |
| InChI | InChI=1S/C32H40FN5O/c1-39-20-4-14-36-15-9-28(10-16-36)37-17-11-29(12-18-37)38-19-13-32(35-38)25-7-8-31-26(21-25)23-27(34-31)22-24-5-2-3-6-30(24)33/h2-3,5-8,13,19,21,23,28-29,34H,4,9-12,14-18,20,22H2,1H3 |
| InChIKey | ZEQZCROSBIAVQN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 49.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|