C23H31ClN6O3 — CID 152637979
(2S)-2-amino-N-[2-chloro-9-[(1S,2R,3S,4R,5R)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-6-yl]-N-(dicyclopropylmethyl)-3-methylbutanamide (PubChem CID 152637979) has the molecular formula C23H31ClN6O3 and a molecular weight of 474.99 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-chloro-9-[(1S,2R,3S,4R,5R)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-6-yl]-N-(dicyclopropylmethyl)-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-chloro-9-[(1S,2R,3S,4R,5R)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-6-yl]-N-(dicyclopropylmethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 152637979 |
| Molecular Formula | C23H31ClN6O3 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (2S)-2-amino-N-[2-chloro-9-[(1S,2R,3S,4R,5R)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]purin-6-yl]-N-(dicyclopropylmethyl)-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)N(c1nc(Cl)nc2c1ncn2[C@H]1[C@H](O)[C@H](O)[C@@H]2C[C@@H]21)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C23H31ClN6O3/c1-9(2)14(25)22(33)30(16(10-3-4-10)11-5-6-11)21-15-20(27-23(24)28-21)29(8-26-15)17-12-7-13(12)18(31)19(17)32/h8-14,16-19,31-32H,3-7,25H2,1-2H3/t12-,13+,14-,17+,18+,19-/m0/s1 |
| InChIKey | ZEYDJFWFRRJKDM-CJDNHNOYSA-N |
| XLogP | 1.90 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |