About 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine
4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine (PubChem CID 15264187) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine |
| PubChem CID | 15264187 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine |
| SMILES | COc1nc(C)nc2c1CSC2 |
| InChI | InChI=1S/C8H10N2OS/c1-5-9-7-4-12-3-6(7)8(10-5)11-2/h3-4H2,1-2H3 |
| InChIKey | FUVAJYGMJHHODH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine?
The IUPAC name of 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine (CID 15264187) is 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine.
What is the SMILES notation for 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine?
The canonical SMILES for 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine is COc1nc(C)nc2c1CSC2.
What is the InChIKey of 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine?
The InChIKey is FUVAJYGMJHHODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c1-5-9-7-4-12-3-6(7)8(10-5)11-2/h3-4H2,1-2H3.
What are the key properties of 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine?
4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine has a molecular weight of 182.25 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-methyl-5,7-dihydrothieno[3,4-d]pyrimidine is sourced from PubChem (CID 15264187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).