C26H22N4O — CID 152642655
4-[6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]benzonitrile (PubChem CID 152642655) has the molecular formula C26H22N4O and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-[6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]benzonitrile.
| Compound Name | 4-[6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 152642655 |
| Molecular Formula | C26H22N4O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-[6-[[4-[(3S)-hex-4-yn-3-yl]phenoxy]methyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]benzonitrile |
| SMILES | CC#C[C@@H](CC)c1ccc(OCc2ccc3nc(-c4ccc(C#N)cc4)nn3c2)cc1 |
| InChI | InChI=1S/C26H22N4O/c1-3-5-21(4-2)22-11-13-24(14-12-22)31-18-20-8-15-25-28-26(29-30(25)17-20)23-9-6-19(16-27)7-10-23/h6-15,17,21H,4,18H2,1-2H3/t21-/m1/s1 |
| InChIKey | ZFWVBJFCGZZEOZ-OAQYLSRUSA-N |
| XLogP | 5.36 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|