About 2,6-dioxo-3,7-dihydropurine-8-carbonitrile
2,6-dioxo-3,7-dihydropurine-8-carbonitrile (PubChem CID 152645473) has the molecular formula C6H3N5O2
and a molecular weight of 177.12 g/mol. Its IUPAC name is 2,6-dioxo-3,7-dihydropurine-8-carbonitrile.
Molecular Properties
| Compound Name | 2,6-dioxo-3,7-dihydropurine-8-carbonitrile |
| PubChem CID | 152645473 |
| Molecular Formula | C6H3N5O2 |
| Molecular Weight | 177.12 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | 2,6-dioxo-3,7-dihydropurine-8-carbonitrile |
| SMILES | N#Cc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C6H3N5O2/c7-1-2-8-3-4(9-2)10-6(13)11-5(3)12/h(H3,8,9,10,11,12,13) |
| InChIKey | ZGLIREPRFCBLDI-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 118.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.12 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-dioxo-3,7-dihydropurine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dioxo-3,7-dihydropurine-8-carbonitrile?
The IUPAC name of 2,6-dioxo-3,7-dihydropurine-8-carbonitrile (CID 152645473) is 2,6-dioxo-3,7-dihydropurine-8-carbonitrile.
What is the SMILES notation for 2,6-dioxo-3,7-dihydropurine-8-carbonitrile?
The canonical SMILES for 2,6-dioxo-3,7-dihydropurine-8-carbonitrile is N#Cc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1.
What is the InChIKey of 2,6-dioxo-3,7-dihydropurine-8-carbonitrile?
The InChIKey is ZGLIREPRFCBLDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N5O2/c7-1-2-8-3-4(9-2)10-6(13)11-5(3)12/h(H3,8,9,10,11,12,13).
What are the key properties of 2,6-dioxo-3,7-dihydropurine-8-carbonitrile?
2,6-dioxo-3,7-dihydropurine-8-carbonitrile has a molecular weight of 177.12 g/mol, XLogP of -1.19, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dioxo-3,7-dihydropurine-8-carbonitrile is sourced from PubChem (CID 152645473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).