C20H48F2N4P2S2Si2 — CID 15264596
2-N,4-N-bis[ditert-butyl(fluoro)silyl]-2-N,4-N,1,3-tetramethyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-diazadiphosphetidine-2,4-diamine (PubChem CID 15264596) has the molecular formula C20H48F2N4P2S2Si2 and a molecular weight of 564.88 g/mol. Its IUPAC name is 2-N,4-N-bis[ditert-butyl(fluoro)silyl]-2-N,4-N,1,3-tetramethyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-diazadiphosphetidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[ditert-butyl(fluoro)silyl]-2-N,4-N,1,3-tetramethyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-diazadiphosphetidine-2,4-diamine |
|---|---|
| PubChem CID | 15264596 |
| Molecular Formula | C20H48F2N4P2S2Si2 |
| Molecular Weight | 564.88 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 2-N,4-N-bis[ditert-butyl(fluoro)silyl]-2-N,4-N,1,3-tetramethyl-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-diazadiphosphetidine-2,4-diamine |
| SMILES | CN([Si](F)(C(C)(C)C)C(C)(C)C)P1(=S)N(C)P(=S)(N(C)[Si](F)(C(C)(C)C)C(C)(C)C)N1C |
| InChI | InChI=1S/C20H48F2N4P2S2Si2/c1-17(2,3)31(21,18(4,5)6)25(15)27(29)23(13)28(30,24(27)14)26(16)32(22,19(7,8)9)20(10,11)12/h1-16H3 |
| InChIKey | WNLWJGCMNBRTRZ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.88 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|