C20H29N5O3 — CID 152646104
tert-butyl 3-[(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanoate (PubChem CID 152646104) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl 3-[(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanoate.
| Compound Name | tert-butyl 3-[(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 152646104 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | tert-butyl 3-[(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanoate |
| SMILES | C[C@@H]1CCN(C(=O)CC(=O)OC(C)(C)C)C[C@@H]1N(C)c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C20H29N5O3/c1-13-7-9-25(16(26)10-17(27)28-20(2,3)4)11-15(13)24(5)19-14-6-8-21-18(14)22-12-23-19/h6,8,12-13,15H,7,9-11H2,1-5H3,(H,21,22,23)/t13-,15+/m1/s1 |
| InChIKey | ZGOLHNZTKPVOFZ-HIFRSBDPSA-N |
| XLogP | 2.36 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|