C13H24BNO3 — CID 15264673
3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1,2-oxazole (PubChem CID 15264673) has the molecular formula C13H24BNO3 and a molecular weight of 253.15 g/mol. Its IUPAC name is 3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 15264673 |
| Molecular Formula | C13H24BNO3 |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5-dihydro-1,2-oxazole |
| SMILES | CC(C)(C)C1=NOC(B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C13H24BNO3/c1-11(2,3)9-8-10(16-15-9)14-17-12(4,5)13(6,7)18-14/h10H,8H2,1-7H3 |
| InChIKey | QPQXOZJBQXVEOQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|