About (2S)-3,3-dimethyl-2-(nitromethyl)butanal
(2S)-3,3-dimethyl-2-(nitromethyl)butanal (PubChem CID 15264859) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-(nitromethyl)butanal.
Molecular Properties
| Compound Name | (2S)-3,3-dimethyl-2-(nitromethyl)butanal |
| PubChem CID | 15264859 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (2S)-3,3-dimethyl-2-(nitromethyl)butanal |
| SMILES | CC(C)(C)[C@H](C=O)C[N+](=O)[O-] |
| InChI | InChI=1S/C7H13NO3/c1-7(2,3)6(5-9)4-8(10)11/h5-6H,4H2,1-3H3/t6-/m0/s1 |
| InChIKey | CYSFFLCLBMXRKH-LURJTMIESA-N |
| XLogP | 1.12 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3,3-dimethyl-2-(nitromethyl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,3-dimethyl-2-(nitromethyl)butanal?
The IUPAC name of (2S)-3,3-dimethyl-2-(nitromethyl)butanal (CID 15264859) is (2S)-3,3-dimethyl-2-(nitromethyl)butanal.
What is the SMILES notation for (2S)-3,3-dimethyl-2-(nitromethyl)butanal?
The canonical SMILES for (2S)-3,3-dimethyl-2-(nitromethyl)butanal is CC(C)(C)[C@H](C=O)C[N+](=O)[O-].
What is the InChIKey of (2S)-3,3-dimethyl-2-(nitromethyl)butanal?
The InChIKey is CYSFFLCLBMXRKH-LURJTMIESA-N. The full InChI is InChI=1S/C7H13NO3/c1-7(2,3)6(5-9)4-8(10)11/h5-6H,4H2,1-3H3/t6-/m0/s1.
What are the key properties of (2S)-3,3-dimethyl-2-(nitromethyl)butanal?
(2S)-3,3-dimethyl-2-(nitromethyl)butanal has a molecular weight of 159.18 g/mol, XLogP of 1.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3-dimethyl-2-(nitromethyl)butanal is sourced from PubChem (CID 15264859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).