About 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine
5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine (PubChem CID 152649050) has the molecular formula C11H21N5O2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine.
Molecular Properties
| Compound Name | 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine |
| PubChem CID | 152649050 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine |
| SMILES | [H]/N=C1/C(C2CCCCC2)CN(C)N([N+](=O)[O-])N1C |
| InChI | InChI=1S/C11H21N5O2/c1-13-8-10(9-6-4-3-5-7-9)11(12)14(2)15(13)16(17)18/h9-10,12H,3-8H2,1-2H3/b12-11- |
| InChIKey | ZHEAGAYLJHUSRE-QXMHVHEDSA-N |
| XLogP | 1.36 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine?
The IUPAC name of 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine (CID 152649050) is 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine.
What is the SMILES notation for 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine?
The canonical SMILES for 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine is [H]/N=C1/C(C2CCCCC2)CN(C)N([N+](=O)[O-])N1C.
What is the InChIKey of 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine?
The InChIKey is ZHEAGAYLJHUSRE-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H21N5O2/c1-13-8-10(9-6-4-3-5-7-9)11(12)14(2)15(13)16(17)18/h9-10,12H,3-8H2,1-2H3/b12-11-.
What are the key properties of 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine?
5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine has a molecular weight of 255.32 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-1,3-dimethyl-2-nitrotriazinan-4-imine is sourced from PubChem (CID 152649050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).