About CID 152649062
CID 152649062 (PubChem CID 152649062) has the molecular formula C9H8
and a molecular weight of 116.16 g/mol.
Molecular Properties
| Compound Name | CID 152649062 |
| PubChem CID | 152649062 |
| Molecular Formula | C9H8 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | — |
| SMILES | C=C=C1CC2=CC=C1C2 |
| InChI | InChI=1S/C9H8/c1-2-8-5-7-3-4-9(8)6-7/h3-4H,1,5-6H2 |
| InChIKey | ZHECOVVBSLCYJK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 152649062 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 152649062?
The IUPAC name of CID 152649062 (CID 152649062) is not available.
What is the SMILES notation for CID 152649062?
The canonical SMILES for CID 152649062 is C=C=C1CC2=CC=C1C2.
What is the InChIKey of CID 152649062?
The InChIKey is ZHECOVVBSLCYJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8/c1-2-8-5-7-3-4-9(8)6-7/h3-4H,1,5-6H2.
What are the key properties of CID 152649062?
CID 152649062 has a molecular weight of 116.16 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 152649062 is sourced from PubChem (CID 152649062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).