C27H52F6O3Si2 — CID 152650057
8,10-bis(2,2,2-trifluoro-1-trimethylsilyloxyethyl)heptadecan-9-one (PubChem CID 152650057) has the molecular formula C27H52F6O3Si2 and a molecular weight of 594.87 g/mol. Its IUPAC name is 8,10-bis(2,2,2-trifluoro-1-trimethylsilyloxyethyl)heptadecan-9-one.
| Compound Name | 8,10-bis(2,2,2-trifluoro-1-trimethylsilyloxyethyl)heptadecan-9-one |
|---|---|
| PubChem CID | 152650057 |
| Molecular Formula | C27H52F6O3Si2 |
| Molecular Weight | 594.87 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | 8,10-bis(2,2,2-trifluoro-1-trimethylsilyloxyethyl)heptadecan-9-one |
| SMILES | CCCCCCCC(C(=O)C(CCCCCCC)C(O[Si](C)(C)C)C(F)(F)F)C(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C27H52F6O3Si2/c1-9-11-13-15-17-19-21(24(26(28,29)30)35-37(3,4)5)23(34)22(20-18-16-14-12-10-2)25(27(31,32)33)36-38(6,7)8/h21-22,24-25H,9-20H2,1-8H3 |
| InChIKey | ZHJFOLARDILEPU-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.87 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|