About (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol
(2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol (PubChem CID 152650725) has the molecular formula C16H13F3N2OS
and a molecular weight of 338.35 g/mol. Its IUPAC name is (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol.
Molecular Properties
| Compound Name | (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol |
| PubChem CID | 152650725 |
| Molecular Formula | C16H13F3N2OS |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol |
| SMILES | OC(c1ccc(C(F)(F)F)cc1)c1c(C2CC2)sc2cncn12 |
| InChI | InChI=1S/C16H13F3N2OS/c17-16(18,19)11-5-3-9(4-6-11)14(22)13-15(10-1-2-10)23-12-7-20-8-21(12)13/h3-8,10,14,22H,1-2H2 |
| InChIKey | ZHMPALBFQAYLPD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol?
The IUPAC name of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol (CID 152650725) is (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol.
What is the SMILES notation for (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol?
The canonical SMILES for (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol is OC(c1ccc(C(F)(F)F)cc1)c1c(C2CC2)sc2cncn12.
What is the InChIKey of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol?
The InChIKey is ZHMPALBFQAYLPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N2OS/c17-16(18,19)11-5-3-9(4-6-11)14(22)13-15(10-1-2-10)23-12-7-20-8-21(12)13/h3-8,10,14,22H,1-2H2.
What are the key properties of (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol?
(2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol has a molecular weight of 338.35 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopropylimidazo[5,1-b][1,3]thiazol-3-yl)-[4-(trifluoromethyl)phenyl]methanol is sourced from PubChem (CID 152650725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).