About (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate
(1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate (PubChem CID 152653401) has the molecular formula C26H17NO5
and a molecular weight of 423.42 g/mol. Its IUPAC name is (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate.
Molecular Properties
| Compound Name | (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate |
| PubChem CID | 152653401 |
| Molecular Formula | C26H17NO5 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate |
| SMILES | Cc1c(OC(=O)Nc2cccc(O)c2)ccc2cc3c(cc12)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C26H17NO5/c1-14-20-13-22-21(24(29)18-7-2-3-8-19(18)25(22)30)11-15(20)9-10-23(14)32-26(31)27-16-5-4-6-17(28)12-16/h2-13,28H,1H3,(H,27,31) |
| InChIKey | ZIAGRXGRKZVVOS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate?
The IUPAC name of (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate (CID 152653401) is (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate.
What is the SMILES notation for (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate?
The canonical SMILES for (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate is Cc1c(OC(=O)Nc2cccc(O)c2)ccc2cc3c(cc12)C(=O)c1ccccc1C3=O.
What is the InChIKey of (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate?
The InChIKey is ZIAGRXGRKZVVOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17NO5/c1-14-20-13-22-21(24(29)18-7-2-3-8-19(18)25(22)30)11-15(20)9-10-23(14)32-26(31)27-16-5-4-6-17(28)12-16/h2-13,28H,1H3,(H,27,31).
What are the key properties of (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate?
(1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate has a molecular weight of 423.42 g/mol, XLogP of 5.24, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-6,11-dioxotetracen-2-yl) N-(3-hydroxyphenyl)carbamate is sourced from PubChem (CID 152653401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).