C18H20ClFN2O3 — CID 152659762
8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 152659762) has the molecular formula C18H20ClFN2O3 and a molecular weight of 366.82 g/mol. Its IUPAC name is 8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 152659762 |
| Molecular Formula | C18H20ClFN2O3 |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 8-chloro-1-ethyl-6-fluoro-7-(3-methylpiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCCC(C)C3)c(Cl)c21 |
| InChI | InChI=1S/C18H20ClFN2O3/c1-3-21-9-12(18(24)25)17(23)11-7-13(20)16(14(19)15(11)21)22-6-4-5-10(2)8-22/h7,9-10H,3-6,8H2,1-2H3,(H,24,25) |
| InChIKey | ZJHNLQLEEPKVTF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |